C6H8I2 — CID 71319210
2,5-diiodohexa-2,4-diene (PubChem CID 71319210) has the molecular formula C6H8I2 and a molecular weight of 333.94 g/mol. Its IUPAC name is 2,5-diiodohexa-2,4-diene.
| Compound Name | 2,5-diiodohexa-2,4-diene |
|---|---|
| PubChem CID | 71319210 |
| Molecular Formula | C6H8I2 |
| Molecular Weight | 333.94 g/mol |
| Exact Mass | 333.87 |
| IUPAC Name | 2,5-diiodohexa-2,4-diene |
| SMILES | CC(I)=CC=C(C)I |
| InChI | InChI=1S/C6H8I2/c1-5(7)3-4-6(2)8/h3-4H,1-2H3 |
| InChIKey | KEBKRKULHKZFTR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.94 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|