C6H7ClIN — CID 167167541
N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine (PubChem CID 167167541) has the molecular formula C6H7ClIN and a molecular weight of 255.49 g/mol. Its IUPAC name is N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 167167541 |
| Molecular Formula | C6H7ClIN |
| Molecular Weight | 255.49 g/mol |
| Exact Mass | 254.93 |
| IUPAC Name | N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine |
| SMILES | C=N/C(Cl)=C\C=C(/C)I |
| InChI | InChI=1S/C6H7ClIN/c1-5(8)3-4-6(7)9-2/h3-4H,2H2,1H3/b5-3+,6-4- |
| InChIKey | UTJVKFRSSWEJEM-UZNMPDEFSA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|