About N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine
N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine (PubChem CID 167167541) has the molecular formula C6H7ClIN
and a molecular weight of 255.49 g/mol. Its IUPAC name is N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine.
Molecular Properties
| Compound Name | N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine |
| PubChem CID | 167167541 |
| Molecular Formula | C6H7ClIN |
| Molecular Weight | 255.49 g/mol |
| Exact Mass | 254.93 |
| IUPAC Name | N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine |
| SMILES | C=N/C(Cl)=C\C=C(/C)I |
| InChI | InChI=1S/C6H7ClIN/c1-5(8)3-4-6(7)9-2/h3-4H,2H2,1H3/b5-3+,6-4- |
| InChIKey | UTJVKFRSSWEJEM-UZNMPDEFSA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine?
The IUPAC name of N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine (CID 167167541) is N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine.
What is the SMILES notation for N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine?
The canonical SMILES for N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine is C=N/C(Cl)=C\C=C(/C)I.
What is the InChIKey of N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine?
The InChIKey is UTJVKFRSSWEJEM-UZNMPDEFSA-N. The full InChI is InChI=1S/C6H7ClIN/c1-5(8)3-4-6(7)9-2/h3-4H,2H2,1H3/b5-3+,6-4-.
What are the key properties of N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine?
N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine has a molecular weight of 255.49 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E,3E)-1-chloro-4-iodopenta-1,3-dienyl]methanimine is sourced from PubChem (CID 167167541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).