C6H8ClI — CID 163726069
(2E,4E)-2-chloro-4-iodohexa-2,4-diene (PubChem CID 163726069) has the molecular formula C6H8ClI and a molecular weight of 242.49 g/mol. Its IUPAC name is (2E,4E)-2-chloro-4-iodohexa-2,4-diene.
| Compound Name | (2E,4E)-2-chloro-4-iodohexa-2,4-diene |
|---|---|
| PubChem CID | 163726069 |
| Molecular Formula | C6H8ClI |
| Molecular Weight | 242.49 g/mol |
| Exact Mass | 241.94 |
| IUPAC Name | (2E,4E)-2-chloro-4-iodohexa-2,4-diene |
| SMILES | C/C=C(I)\C=C(/C)Cl |
| InChI | InChI=1S/C6H8ClI/c1-3-6(8)4-5(2)7/h3-4H,1-2H3/b5-4+,6-3+ |
| InChIKey | KVQYVVHPWYGMFQ-UTTVJGTNSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|