About bis((Z)-3-chlorobut-2-enoate);mercury(2+)
bis((Z)-3-chlorobut-2-enoate);mercury(2+) (PubChem CID 22603930) has the molecular formula C8H8Cl2HgO4
and a molecular weight of 439.64 g/mol. Its IUPAC name is bis((Z)-3-chlorobut-2-enoate);mercury(2+).
Molecular Properties
| Compound Name | bis((Z)-3-chlorobut-2-enoate);mercury(2+) |
| PubChem CID | 22603930 |
| Molecular Formula | C8H8Cl2HgO4 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.95 |
| IUPAC Name | bis((Z)-3-chlorobut-2-enoate);mercury(2+) |
| SMILES | C/C(Cl)=C/C(=O)[O-].C/C(Cl)=C/C(=O)[O-].[Hg+2] |
| InChI | InChI=1S/2C4H5ClO2.Hg/c2*1-3(5)2-4(6)7;/h2*2H,1H3,(H,6,7);/q;;+2/p-2/b2*3-2-; |
| InChIKey | MYQMRSRDHNTHBJ-OZWADYBTSA-L |
| XLogP | -0.24 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((Z)-3-chlorobut-2-enoate);mercury(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((Z)-3-chlorobut-2-enoate);mercury(2+)?
The IUPAC name of bis((Z)-3-chlorobut-2-enoate);mercury(2+) (CID 22603930) is bis((Z)-3-chlorobut-2-enoate);mercury(2+).
What is the SMILES notation for bis((Z)-3-chlorobut-2-enoate);mercury(2+)?
The canonical SMILES for bis((Z)-3-chlorobut-2-enoate);mercury(2+) is C/C(Cl)=C/C(=O)[O-].C/C(Cl)=C/C(=O)[O-].[Hg+2].
What is the InChIKey of bis((Z)-3-chlorobut-2-enoate);mercury(2+)?
The InChIKey is MYQMRSRDHNTHBJ-OZWADYBTSA-L. The full InChI is InChI=1S/2C4H5ClO2.Hg/c2*1-3(5)2-4(6)7;/h2*2H,1H3,(H,6,7);/q;;+2/p-2/b2*3-2-;.
What are the key properties of bis((Z)-3-chlorobut-2-enoate);mercury(2+)?
bis((Z)-3-chlorobut-2-enoate);mercury(2+) has a molecular weight of 439.64 g/mol, XLogP of -0.24, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis((Z)-3-chlorobut-2-enoate);mercury(2+) is sourced from PubChem (CID 22603930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).