About (E)-2,5-dichlorohex-4-en-3-one
(E)-2,5-dichlorohex-4-en-3-one (PubChem CID 123840362) has the molecular formula C6H8Cl2O
and a molecular weight of 167.03 g/mol. Its IUPAC name is (E)-2,5-dichlorohex-4-en-3-one.
Molecular Properties
| Compound Name | (E)-2,5-dichlorohex-4-en-3-one |
| PubChem CID | 123840362 |
| Molecular Formula | C6H8Cl2O |
| Molecular Weight | 167.03 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | (E)-2,5-dichlorohex-4-en-3-one |
| SMILES | C/C(Cl)=C\C(=O)C(C)Cl |
| InChI | InChI=1S/C6H8Cl2O/c1-4(7)3-6(9)5(2)8/h3,5H,1-2H3/b4-3+ |
| InChIKey | SUFYCCQRQYVNDX-ONEGZZNKSA-N |
| XLogP | 2.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.03 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,5-dichlorohex-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,5-dichlorohex-4-en-3-one?
The IUPAC name of (E)-2,5-dichlorohex-4-en-3-one (CID 123840362) is (E)-2,5-dichlorohex-4-en-3-one.
What is the SMILES notation for (E)-2,5-dichlorohex-4-en-3-one?
The canonical SMILES for (E)-2,5-dichlorohex-4-en-3-one is C/C(Cl)=C\C(=O)C(C)Cl.
What is the InChIKey of (E)-2,5-dichlorohex-4-en-3-one?
The InChIKey is SUFYCCQRQYVNDX-ONEGZZNKSA-N. The full InChI is InChI=1S/C6H8Cl2O/c1-4(7)3-6(9)5(2)8/h3,5H,1-2H3/b4-3+.
What are the key properties of (E)-2,5-dichlorohex-4-en-3-one?
(E)-2,5-dichlorohex-4-en-3-one has a molecular weight of 167.03 g/mol, XLogP of 2.33, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,5-dichlorohex-4-en-3-one is sourced from PubChem (CID 123840362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).