C7H7BrClN — CID 178148977
N-[(1E)-4-bromo-1-chloro-3-methylidenepenta-1,4-dienyl]methanimine (PubChem CID 178148977) has the molecular formula C7H7BrClN and a molecular weight of 220.50 g/mol. Its IUPAC name is N-[(1E)-4-bromo-1-chloro-3-methylidenepenta-1,4-dienyl]methanimine.
| Compound Name | N-[(1E)-4-bromo-1-chloro-3-methylidenepenta-1,4-dienyl]methanimine |
|---|---|
| PubChem CID | 178148977 |
| Molecular Formula | C7H7BrClN |
| Molecular Weight | 220.50 g/mol |
| Exact Mass | 218.95 |
| IUPAC Name | N-[(1E)-4-bromo-1-chloro-3-methylidenepenta-1,4-dienyl]methanimine |
| SMILES | C=N/C(Cl)=C\C(=C)C(=C)Br |
| InChI | InChI=1S/C7H7BrClN/c1-5(6(2)8)4-7(9)10-3/h4H,1-3H2/b7-4- |
| InChIKey | YVLRHZRFTHCBHQ-DAXSKMNVSA-N |
| XLogP | 3.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|