C8H13BrN2 — CID 143720548
(3E,5E)-6-bromo-4-methyl-6-(methylideneamino)hexa-3,5-dien-3-amine (PubChem CID 143720548) has the molecular formula C8H13BrN2 and a molecular weight of 217.11 g/mol. Its IUPAC name is (3E,5E)-6-bromo-4-methyl-6-(methylideneamino)hexa-3,5-dien-3-amine.
| Compound Name | (3E,5E)-6-bromo-4-methyl-6-(methylideneamino)hexa-3,5-dien-3-amine |
|---|---|
| PubChem CID | 143720548 |
| Molecular Formula | C8H13BrN2 |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | (3E,5E)-6-bromo-4-methyl-6-(methylideneamino)hexa-3,5-dien-3-amine |
| SMILES | C=N/C(Br)=C\C(C)=C(\N)CC |
| InChI | InChI=1S/C8H13BrN2/c1-4-7(10)6(2)5-8(9)11-3/h5H,3-4,10H2,1-2H3/b7-6+,8-5- |
| InChIKey | XRWYRGKITGEJMX-NGWHPUCNSA-N |
| XLogP | 2.57 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|