About 4-bromohept-3-en-3-amine
4-bromohept-3-en-3-amine (PubChem CID 173294864) has the molecular formula C7H14BrN
and a molecular weight of 192.10 g/mol. Its IUPAC name is 4-bromohept-3-en-3-amine.
Molecular Properties
| Compound Name | 4-bromohept-3-en-3-amine |
| PubChem CID | 173294864 |
| Molecular Formula | C7H14BrN |
| Molecular Weight | 192.10 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 4-bromohept-3-en-3-amine |
| SMILES | CCCC(Br)=C(N)CC |
| InChI | InChI=1S/C7H14BrN/c1-3-5-6(8)7(9)4-2/h3-5,9H2,1-2H3 |
| InChIKey | VZMAITCGCMIEEY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.10 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromohept-3-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromohept-3-en-3-amine?
The IUPAC name of 4-bromohept-3-en-3-amine (CID 173294864) is 4-bromohept-3-en-3-amine.
What is the SMILES notation for 4-bromohept-3-en-3-amine?
The canonical SMILES for 4-bromohept-3-en-3-amine is CCCC(Br)=C(N)CC.
What is the InChIKey of 4-bromohept-3-en-3-amine?
The InChIKey is VZMAITCGCMIEEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14BrN/c1-3-5-6(8)7(9)4-2/h3-5,9H2,1-2H3.
What are the key properties of 4-bromohept-3-en-3-amine?
4-bromohept-3-en-3-amine has a molecular weight of 192.10 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromohept-3-en-3-amine is sourced from PubChem (CID 173294864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).