About N-methylbutanimidoyl bromide
N-methylbutanimidoyl bromide (PubChem CID 123677307) has the molecular formula C5H10BrN
and a molecular weight of 164.05 g/mol. Its IUPAC name is N-methylbutanimidoyl bromide.
Molecular Properties
| Compound Name | N-methylbutanimidoyl bromide |
| PubChem CID | 123677307 |
| Molecular Formula | C5H10BrN |
| Molecular Weight | 164.05 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | N-methylbutanimidoyl bromide |
| SMILES | CCC/C(Br)=N/C |
| InChI | InChI=1S/C5H10BrN/c1-3-4-5(6)7-2/h3-4H2,1-2H3/b7-5- |
| InChIKey | PWMZCYUJRKJVFT-ALCCZGGFSA-N |
| XLogP | 2.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.05 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methylbutanimidoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylbutanimidoyl bromide?
The IUPAC name of N-methylbutanimidoyl bromide (CID 123677307) is N-methylbutanimidoyl bromide.
What is the SMILES notation for N-methylbutanimidoyl bromide?
The canonical SMILES for N-methylbutanimidoyl bromide is CCC/C(Br)=N/C.
What is the InChIKey of N-methylbutanimidoyl bromide?
The InChIKey is PWMZCYUJRKJVFT-ALCCZGGFSA-N. The full InChI is InChI=1S/C5H10BrN/c1-3-4-5(6)7-2/h3-4H2,1-2H3/b7-5-.
What are the key properties of N-methylbutanimidoyl bromide?
N-methylbutanimidoyl bromide has a molecular weight of 164.05 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylbutanimidoyl bromide is sourced from PubChem (CID 123677307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).