About N-methyliminobutanamide
N-methyliminobutanamide (PubChem CID 141214785) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is N-methyliminobutanamide.
Molecular Properties
| Compound Name | N-methyliminobutanamide |
| PubChem CID | 141214785 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | N-methyliminobutanamide |
| SMILES | CCCC(=O)/N=N/C |
| InChI | InChI=1S/C5H10N2O/c1-3-4-5(8)7-6-2/h3-4H2,1-2H3/b7-6+ |
| InChIKey | GJWUBAVWXXCKEA-VOTSOKGWSA-N |
| XLogP | 1.40 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze N-methyliminobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyliminobutanamide?
The IUPAC name of N-methyliminobutanamide (CID 141214785) is N-methyliminobutanamide.
What is the SMILES notation for N-methyliminobutanamide?
The canonical SMILES for N-methyliminobutanamide is CCCC(=O)/N=N/C.
What is the InChIKey of N-methyliminobutanamide?
The InChIKey is GJWUBAVWXXCKEA-VOTSOKGWSA-N. The full InChI is InChI=1S/C5H10N2O/c1-3-4-5(8)7-6-2/h3-4H2,1-2H3/b7-6+.
What are the key properties of N-methyliminobutanamide?
N-methyliminobutanamide has a molecular weight of 114.15 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyliminobutanamide is sourced from PubChem (CID 141214785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).