About N-phenyliminobutanamide
N-phenyliminobutanamide (PubChem CID 123707151) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is N-phenyliminobutanamide.
Molecular Properties
| Compound Name | N-phenyliminobutanamide |
| PubChem CID | 123707151 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | N-phenyliminobutanamide |
| SMILES | CCCC(=O)/N=N/c1ccccc1 |
| InChI | InChI=1S/C10H12N2O/c1-2-6-10(13)12-11-9-7-4-3-5-8-9/h3-5,7-8H,2,6H2,1H3/b12-11+ |
| InChIKey | OMORCNXDFFKXMC-VAWYXSNFSA-N |
| XLogP | 3.10 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze N-phenyliminobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyliminobutanamide?
The IUPAC name of N-phenyliminobutanamide (CID 123707151) is N-phenyliminobutanamide.
What is the SMILES notation for N-phenyliminobutanamide?
The canonical SMILES for N-phenyliminobutanamide is CCCC(=O)/N=N/c1ccccc1.
What is the InChIKey of N-phenyliminobutanamide?
The InChIKey is OMORCNXDFFKXMC-VAWYXSNFSA-N. The full InChI is InChI=1S/C10H12N2O/c1-2-6-10(13)12-11-9-7-4-3-5-8-9/h3-5,7-8H,2,6H2,1H3/b12-11+.
What are the key properties of N-phenyliminobutanamide?
N-phenyliminobutanamide has a molecular weight of 176.22 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyliminobutanamide is sourced from PubChem (CID 123707151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).