About 3-methyliminohexan-2-one
3-methyliminohexan-2-one (PubChem CID 123425712) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is 3-methyliminohexan-2-one.
Molecular Properties
| Compound Name | 3-methyliminohexan-2-one |
| PubChem CID | 123425712 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 3-methyliminohexan-2-one |
| SMILES | CCC/C(=N\C)C(C)=O |
| InChI | InChI=1S/C7H13NO/c1-4-5-7(8-3)6(2)9/h4-5H2,1-3H3/b8-7+ |
| InChIKey | AMHFZIJORICWHS-BQYQJAHWSA-N |
| XLogP | 1.45 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyliminohexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyliminohexan-2-one?
The IUPAC name of 3-methyliminohexan-2-one (CID 123425712) is 3-methyliminohexan-2-one.
What is the SMILES notation for 3-methyliminohexan-2-one?
The canonical SMILES for 3-methyliminohexan-2-one is CCC/C(=N\C)C(C)=O.
What is the InChIKey of 3-methyliminohexan-2-one?
The InChIKey is AMHFZIJORICWHS-BQYQJAHWSA-N. The full InChI is InChI=1S/C7H13NO/c1-4-5-7(8-3)6(2)9/h4-5H2,1-3H3/b8-7+.
What are the key properties of 3-methyliminohexan-2-one?
3-methyliminohexan-2-one has a molecular weight of 127.19 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyliminohexan-2-one is sourced from PubChem (CID 123425712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).