About N-oxobutanamide
N-oxobutanamide (PubChem CID 87293137) has the molecular formula C4H7NO2
and a molecular weight of 101.11 g/mol. Its IUPAC name is N-oxobutanamide.
Molecular Properties
| Compound Name | N-oxobutanamide |
| PubChem CID | 87293137 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 101.11 g/mol |
| Exact Mass | 101.05 |
| IUPAC Name | N-oxobutanamide |
| SMILES | CCCC(=O)N=O |
| InChI | InChI=1S/C4H7NO2/c1-2-3-4(6)5-7/h2-3H2,1H3 |
| InChIKey | MTZAEAOFEVAEMX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.11 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oxobutanamide?
The IUPAC name of N-oxobutanamide (CID 87293137) is N-oxobutanamide.
What is the SMILES notation for N-oxobutanamide?
The canonical SMILES for N-oxobutanamide is CCCC(=O)N=O.
What is the InChIKey of N-oxobutanamide?
The InChIKey is MTZAEAOFEVAEMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2/c1-2-3-4(6)5-7/h2-3H2,1H3.
What are the key properties of N-oxobutanamide?
N-oxobutanamide has a molecular weight of 101.11 g/mol, XLogP of 1.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-oxobutanamide is sourced from PubChem (CID 87293137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).