About N-oxotetradecanamide
N-oxotetradecanamide (PubChem CID 87730431) has the molecular formula C14H27NO2
and a molecular weight of 241.37 g/mol. Its IUPAC name is N-oxotetradecanamide.
Molecular Properties
| Compound Name | N-oxotetradecanamide |
| PubChem CID | 87730431 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | N-oxotetradecanamide |
| SMILES | CCCCCCCCCCCCCC(=O)N=O |
| InChI | InChI=1S/C14H27NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(16)15-17/h2-13H2,1H3 |
| InChIKey | MVICPCVQGBPRDC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-oxotetradecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oxotetradecanamide?
The IUPAC name of N-oxotetradecanamide (CID 87730431) is N-oxotetradecanamide.
What is the SMILES notation for N-oxotetradecanamide?
The canonical SMILES for N-oxotetradecanamide is CCCCCCCCCCCCCC(=O)N=O.
What is the InChIKey of N-oxotetradecanamide?
The InChIKey is MVICPCVQGBPRDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(16)15-17/h2-13H2,1H3.
What are the key properties of N-oxotetradecanamide?
N-oxotetradecanamide has a molecular weight of 241.37 g/mol, XLogP of 4.98, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-oxotetradecanamide is sourced from PubChem (CID 87730431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).