About nonanoyl isothiocyanate
nonanoyl isothiocyanate (PubChem CID 19774855) has the molecular formula C10H17NOS
and a molecular weight of 199.32 g/mol. Its IUPAC name is nonanoyl isothiocyanate.
Molecular Properties
| Compound Name | nonanoyl isothiocyanate |
| PubChem CID | 19774855 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | nonanoyl isothiocyanate |
| SMILES | CCCCCCCCC(=O)N=C=S |
| InChI | InChI=1S/C10H17NOS/c1-2-3-4-5-6-7-8-10(12)11-9-13/h2-8H2,1H3 |
| InChIKey | ZUCLMVVTOVCONH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze nonanoyl isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonanoyl isothiocyanate?
The IUPAC name of nonanoyl isothiocyanate (CID 19774855) is nonanoyl isothiocyanate.
What is the SMILES notation for nonanoyl isothiocyanate?
The canonical SMILES for nonanoyl isothiocyanate is CCCCCCCCC(=O)N=C=S.
What is the InChIKey of nonanoyl isothiocyanate?
The InChIKey is ZUCLMVVTOVCONH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NOS/c1-2-3-4-5-6-7-8-10(12)11-9-13/h2-8H2,1H3.
What are the key properties of nonanoyl isothiocyanate?
nonanoyl isothiocyanate has a molecular weight of 199.32 g/mol, XLogP of 3.37, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonanoyl isothiocyanate is sourced from PubChem (CID 19774855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).