About N-oxooctanamide
N-oxooctanamide (PubChem CID 87234486) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is N-oxooctanamide.
Molecular Properties
| Compound Name | N-oxooctanamide |
| PubChem CID | 87234486 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | N-oxooctanamide |
| SMILES | CCCCCCCC(=O)N=O |
| InChI | InChI=1S/C8H15NO2/c1-2-3-4-5-6-7-8(10)9-11/h2-7H2,1H3 |
| InChIKey | GKOKWEVCYXCXST-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-oxooctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oxooctanamide?
The IUPAC name of N-oxooctanamide (CID 87234486) is N-oxooctanamide.
What is the SMILES notation for N-oxooctanamide?
The canonical SMILES for N-oxooctanamide is CCCCCCCC(=O)N=O.
What is the InChIKey of N-oxooctanamide?
The InChIKey is GKOKWEVCYXCXST-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-2-3-4-5-6-7-8(10)9-11/h2-7H2,1H3.
What are the key properties of N-oxooctanamide?
N-oxooctanamide has a molecular weight of 157.21 g/mol, XLogP of 2.64, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-oxooctanamide is sourced from PubChem (CID 87234486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).