About 8-bromo-N-oxooctanamide
8-bromo-N-oxooctanamide (PubChem CID 118895802) has the molecular formula C8H14BrNO2
and a molecular weight of 236.11 g/mol. Its IUPAC name is 8-bromo-N-oxooctanamide.
Molecular Properties
| Compound Name | 8-bromo-N-oxooctanamide |
| PubChem CID | 118895802 |
| Molecular Formula | C8H14BrNO2 |
| Molecular Weight | 236.11 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 8-bromo-N-oxooctanamide |
| SMILES | O=NC(=O)CCCCCCCBr |
| InChI | InChI=1S/C8H14BrNO2/c9-7-5-3-1-2-4-6-8(11)10-12/h1-7H2 |
| InChIKey | SVPIUTVMBONEFX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.11 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-N-oxooctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-N-oxooctanamide?
The IUPAC name of 8-bromo-N-oxooctanamide (CID 118895802) is 8-bromo-N-oxooctanamide.
What is the SMILES notation for 8-bromo-N-oxooctanamide?
The canonical SMILES for 8-bromo-N-oxooctanamide is O=NC(=O)CCCCCCCBr.
What is the InChIKey of 8-bromo-N-oxooctanamide?
The InChIKey is SVPIUTVMBONEFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14BrNO2/c9-7-5-3-1-2-4-6-8(11)10-12/h1-7H2.
What are the key properties of 8-bromo-N-oxooctanamide?
8-bromo-N-oxooctanamide has a molecular weight of 236.11 g/mol, XLogP of 3.01, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-N-oxooctanamide is sourced from PubChem (CID 118895802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).