C6H9NO3 — CID 146976894
N,5-dioxohexanamide (PubChem CID 146976894) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is N,5-dioxohexanamide.
| Compound Name | N,5-dioxohexanamide |
|---|---|
| PubChem CID | 146976894 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | N,5-dioxohexanamide |
| SMILES | CC(=O)CCCC(=O)N=O |
| InChI | InChI=1S/C6H9NO3/c1-5(8)3-2-4-6(9)7-10/h2-4H2,1H3 |
| InChIKey | ANNSTFZUJUYDSO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |