About N,5-dioxohexanamide
N,5-dioxohexanamide (PubChem CID 146976894) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is N,5-dioxohexanamide.
Molecular Properties
| Compound Name | N,5-dioxohexanamide |
| PubChem CID | 146976894 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | N,5-dioxohexanamide |
| SMILES | CC(=O)CCCC(=O)N=O |
| InChI | InChI=1S/C6H9NO3/c1-5(8)3-2-4-6(9)7-10/h2-4H2,1H3 |
| InChIKey | ANNSTFZUJUYDSO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,5-dioxohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-dioxohexanamide?
The IUPAC name of N,5-dioxohexanamide (CID 146976894) is N,5-dioxohexanamide.
What is the SMILES notation for N,5-dioxohexanamide?
The canonical SMILES for N,5-dioxohexanamide is CC(=O)CCCC(=O)N=O.
What is the InChIKey of N,5-dioxohexanamide?
The InChIKey is ANNSTFZUJUYDSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-5(8)3-2-4-6(9)7-10/h2-4H2,1H3.
What are the key properties of N,5-dioxohexanamide?
N,5-dioxohexanamide has a molecular weight of 143.14 g/mol, XLogP of 1.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-dioxohexanamide is sourced from PubChem (CID 146976894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).