About N,4-dioxopentanamide
N,4-dioxopentanamide (PubChem CID 87531074) has the molecular formula C5H7NO3
and a molecular weight of 129.11 g/mol. Its IUPAC name is N,4-dioxopentanamide.
Molecular Properties
| Compound Name | N,4-dioxopentanamide |
| PubChem CID | 87531074 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | N,4-dioxopentanamide |
| SMILES | CC(=O)CCC(=O)N=O |
| InChI | InChI=1S/C5H7NO3/c1-4(7)2-3-5(8)6-9/h2-3H2,1H3 |
| InChIKey | GMXVDGYPBRYYBP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,4-dioxopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dioxopentanamide?
The IUPAC name of N,4-dioxopentanamide (CID 87531074) is N,4-dioxopentanamide.
What is the SMILES notation for N,4-dioxopentanamide?
The canonical SMILES for N,4-dioxopentanamide is CC(=O)CCC(=O)N=O.
What is the InChIKey of N,4-dioxopentanamide?
The InChIKey is GMXVDGYPBRYYBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3/c1-4(7)2-3-5(8)6-9/h2-3H2,1H3.
What are the key properties of N,4-dioxopentanamide?
N,4-dioxopentanamide has a molecular weight of 129.11 g/mol, XLogP of 0.65, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dioxopentanamide is sourced from PubChem (CID 87531074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).