About N-imino-4-oxopentanamide
N-imino-4-oxopentanamide (PubChem CID 59086798) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is N-imino-4-oxopentanamide.
Molecular Properties
| Compound Name | N-imino-4-oxopentanamide |
| PubChem CID | 59086798 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | N-imino-4-oxopentanamide |
| SMILES | [H]/N=N/C(=O)CCC(C)=O |
| InChI | InChI=1S/C5H8N2O2/c1-4(8)2-3-5(9)7-6/h6H,2-3H2,1H3/b7-6+ |
| InChIKey | YYOHOMXUUKHHAU-VOTSOKGWSA-N |
| XLogP | 0.91 |
| TPSA | 70.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze N-imino-4-oxopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-imino-4-oxopentanamide?
The IUPAC name of N-imino-4-oxopentanamide (CID 59086798) is N-imino-4-oxopentanamide.
What is the SMILES notation for N-imino-4-oxopentanamide?
The canonical SMILES for N-imino-4-oxopentanamide is [H]/N=N/C(=O)CCC(C)=O.
What is the InChIKey of N-imino-4-oxopentanamide?
The InChIKey is YYOHOMXUUKHHAU-VOTSOKGWSA-N. The full InChI is InChI=1S/C5H8N2O2/c1-4(8)2-3-5(9)7-6/h6H,2-3H2,1H3/b7-6+.
What are the key properties of N-imino-4-oxopentanamide?
N-imino-4-oxopentanamide has a molecular weight of 128.13 g/mol, XLogP of 0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-imino-4-oxopentanamide is sourced from PubChem (CID 59086798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).