C7H13N5O2 — CID 175431476
2-[(dimethylamino)methyl]-N,N'-diiminobutanediamide (PubChem CID 175431476) has the molecular formula C7H13N5O2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-N,N'-diiminobutanediamide.
| Compound Name | 2-[(dimethylamino)methyl]-N,N'-diiminobutanediamide |
|---|---|
| PubChem CID | 175431476 |
| Molecular Formula | C7H13N5O2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-[(dimethylamino)methyl]-N,N'-diiminobutanediamide |
| SMILES | [H]/N=N/C(=O)CC(CN(C)C)C(=O)/N=N/[H] |
| InChI | InChI=1S/C7H13N5O2/c1-12(2)4-5(7(14)11-9)3-6(13)10-8/h5,8-9H,3-4H2,1-2H3/b10-8+,11-9+ |
| InChIKey | VELVAPUDAYFPHA-GFULKKFKSA-N |
| XLogP | 0.67 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|