About 2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride
2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride (PubChem CID 160536881) has the molecular formula C8H18ClN3O2
and a molecular weight of 223.70 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride |
| PubChem CID | 160536881 |
| Molecular Formula | C8H18ClN3O2 |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride |
| SMILES | CCC(CN(C)C)C(=O)O.Cl.N=C=N |
| InChI | InChI=1S/C7H15NO2.CH2N2.ClH/c1-4-6(7(9)10)5-8(2)3;2-1-3;/h6H,4-5H2,1-3H3,(H,9,10);2-3H;1H |
| InChIKey | PYBPXDYJJJXSID-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride?
The IUPAC name of 2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride (CID 160536881) is 2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride.
What is the SMILES notation for 2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride?
The canonical SMILES for 2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride is CCC(CN(C)C)C(=O)O.Cl.N=C=N.
What is the InChIKey of 2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride?
The InChIKey is PYBPXDYJJJXSID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.CH2N2.ClH/c1-4-6(7(9)10)5-8(2)3;2-1-3;/h6H,4-5H2,1-3H3,(H,9,10);2-3H;1H.
What are the key properties of 2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride?
2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride has a molecular weight of 223.70 g/mol, XLogP of 1.40, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(dimethylamino)methyl]butanoic acid;methanediimine;hydrochloride is sourced from PubChem (CID 160536881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).