About (Z)-6-ethoxy-N,4-dioxohept-5-enamide
(Z)-6-ethoxy-N,4-dioxohept-5-enamide (PubChem CID 126591471) has the molecular formula C9H13NO4
and a molecular weight of 199.21 g/mol. Its IUPAC name is (Z)-6-ethoxy-N,4-dioxohept-5-enamide.
Molecular Properties
| Compound Name | (Z)-6-ethoxy-N,4-dioxohept-5-enamide |
| PubChem CID | 126591471 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (Z)-6-ethoxy-N,4-dioxohept-5-enamide |
| SMILES | CCO/C(C)=C\C(=O)CCC(=O)N=O |
| InChI | InChI=1S/C9H13NO4/c1-3-14-7(2)6-8(11)4-5-9(12)10-13/h6H,3-5H2,1-2H3/b7-6- |
| InChIKey | QBJVPZMKXYKWQW-SREVYHEPSA-N |
| XLogP | 1.57 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6-ethoxy-N,4-dioxohept-5-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6-ethoxy-N,4-dioxohept-5-enamide?
The IUPAC name of (Z)-6-ethoxy-N,4-dioxohept-5-enamide (CID 126591471) is (Z)-6-ethoxy-N,4-dioxohept-5-enamide.
What is the SMILES notation for (Z)-6-ethoxy-N,4-dioxohept-5-enamide?
The canonical SMILES for (Z)-6-ethoxy-N,4-dioxohept-5-enamide is CCO/C(C)=C\C(=O)CCC(=O)N=O.
What is the InChIKey of (Z)-6-ethoxy-N,4-dioxohept-5-enamide?
The InChIKey is QBJVPZMKXYKWQW-SREVYHEPSA-N. The full InChI is InChI=1S/C9H13NO4/c1-3-14-7(2)6-8(11)4-5-9(12)10-13/h6H,3-5H2,1-2H3/b7-6-.
What are the key properties of (Z)-6-ethoxy-N,4-dioxohept-5-enamide?
(Z)-6-ethoxy-N,4-dioxohept-5-enamide has a molecular weight of 199.21 g/mol, XLogP of 1.57, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6-ethoxy-N,4-dioxohept-5-enamide is sourced from PubChem (CID 126591471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).