C5H4N2O5 — CID 88556785
N,N',2-trioxopentanediamide (PubChem CID 88556785) has the molecular formula C5H4N2O5 and a molecular weight of 172.10 g/mol. Its IUPAC name is N,N',2-trioxopentanediamide.
| Compound Name | N,N',2-trioxopentanediamide |
|---|---|
| PubChem CID | 88556785 |
| Molecular Formula | C5H4N2O5 |
| Molecular Weight | 172.10 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | N,N',2-trioxopentanediamide |
| SMILES | O=NC(=O)CCC(=O)C(=O)N=O |
| InChI | InChI=1S/C5H4N2O5/c8-3(5(10)7-12)1-2-4(9)6-11/h1-2H2 |
| InChIKey | IXTAGXOFIPMBGM-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.10 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|