About 2-amino-N-oxoacetamide
2-amino-N-oxoacetamide (PubChem CID 173469497) has the molecular formula C2H4N2O2
and a molecular weight of 88.07 g/mol. Its IUPAC name is 2-amino-N-oxoacetamide.
Molecular Properties
| Compound Name | 2-amino-N-oxoacetamide |
| PubChem CID | 173469497 |
| Molecular Formula | C2H4N2O2 |
| Molecular Weight | 88.07 g/mol |
| Exact Mass | 88.03 |
| IUPAC Name | 2-amino-N-oxoacetamide |
| SMILES | NCC(=O)N=O |
| InChI | InChI=1S/C2H4N2O2/c3-1-2(5)4-6/h1,3H2 |
| InChIKey | BUGNENGOCSDYFF-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.07 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-N-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-oxoacetamide?
The IUPAC name of 2-amino-N-oxoacetamide (CID 173469497) is 2-amino-N-oxoacetamide.
What is the SMILES notation for 2-amino-N-oxoacetamide?
The canonical SMILES for 2-amino-N-oxoacetamide is NCC(=O)N=O.
What is the InChIKey of 2-amino-N-oxoacetamide?
The InChIKey is BUGNENGOCSDYFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N2O2/c3-1-2(5)4-6/h1,3H2.
What are the key properties of 2-amino-N-oxoacetamide?
2-amino-N-oxoacetamide has a molecular weight of 88.07 g/mol, XLogP of -0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-oxoacetamide is sourced from PubChem (CID 173469497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).