About 2-hydroxytetradecanoyl isothiocyanate
2-hydroxytetradecanoyl isothiocyanate (PubChem CID 71375409) has the molecular formula C15H27NO2S
and a molecular weight of 285.45 g/mol. Its IUPAC name is 2-hydroxytetradecanoyl isothiocyanate.
Molecular Properties
| Compound Name | 2-hydroxytetradecanoyl isothiocyanate |
| PubChem CID | 71375409 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2-hydroxytetradecanoyl isothiocyanate |
| SMILES | CCCCCCCCCCCCC(O)C(=O)N=C=S |
| InChI | InChI=1S/C15H27NO2S/c1-2-3-4-5-6-7-8-9-10-11-12-14(17)15(18)16-13-19/h14,17H,2-12H2,1H3 |
| InChIKey | RSVBJUFTSWKVLT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxytetradecanoyl isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxytetradecanoyl isothiocyanate?
The IUPAC name of 2-hydroxytetradecanoyl isothiocyanate (CID 71375409) is 2-hydroxytetradecanoyl isothiocyanate.
What is the SMILES notation for 2-hydroxytetradecanoyl isothiocyanate?
The canonical SMILES for 2-hydroxytetradecanoyl isothiocyanate is CCCCCCCCCCCCC(O)C(=O)N=C=S.
What is the InChIKey of 2-hydroxytetradecanoyl isothiocyanate?
The InChIKey is RSVBJUFTSWKVLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2S/c1-2-3-4-5-6-7-8-9-10-11-12-14(17)15(18)16-13-19/h14,17H,2-12H2,1H3.
What are the key properties of 2-hydroxytetradecanoyl isothiocyanate?
2-hydroxytetradecanoyl isothiocyanate has a molecular weight of 285.45 g/mol, XLogP of 4.29, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxytetradecanoyl isothiocyanate is sourced from PubChem (CID 71375409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).