About 5-methyloct-4-en-4-amine
5-methyloct-4-en-4-amine (PubChem CID 176900512) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is 5-methyloct-4-en-4-amine.
Molecular Properties
| Compound Name | 5-methyloct-4-en-4-amine |
| PubChem CID | 176900512 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 5-methyloct-4-en-4-amine |
| SMILES | CCCC(C)=C(N)CCC |
| InChI | InChI=1S/C9H19N/c1-4-6-8(3)9(10)7-5-2/h4-7,10H2,1-3H3 |
| InChIKey | CEAXPYGZBQHZJE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyloct-4-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyloct-4-en-4-amine?
The IUPAC name of 5-methyloct-4-en-4-amine (CID 176900512) is 5-methyloct-4-en-4-amine.
What is the SMILES notation for 5-methyloct-4-en-4-amine?
The canonical SMILES for 5-methyloct-4-en-4-amine is CCCC(C)=C(N)CCC.
What is the InChIKey of 5-methyloct-4-en-4-amine?
The InChIKey is CEAXPYGZBQHZJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N/c1-4-6-8(3)9(10)7-5-2/h4-7,10H2,1-3H3.
What are the key properties of 5-methyloct-4-en-4-amine?
5-methyloct-4-en-4-amine has a molecular weight of 141.26 g/mol, XLogP of 2.82, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyloct-4-en-4-amine is sourced from PubChem (CID 176900512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).