C8H13BrO — CID 134176188
(3E)-2-bromo-4-ethoxyhexa-1,3-diene (PubChem CID 134176188) has the molecular formula C8H13BrO and a molecular weight of 205.09 g/mol. Its IUPAC name is (3E)-2-bromo-4-ethoxyhexa-1,3-diene.
| Compound Name | (3E)-2-bromo-4-ethoxyhexa-1,3-diene |
|---|---|
| PubChem CID | 134176188 |
| Molecular Formula | C8H13BrO |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | (3E)-2-bromo-4-ethoxyhexa-1,3-diene |
| SMILES | C=C(Br)/C=C(\CC)OCC |
| InChI | InChI=1S/C8H13BrO/c1-4-8(10-5-2)6-7(3)9/h6H,3-5H2,1-2H3/b8-6+ |
| InChIKey | DKYQHAHNGQXIMD-SOFGYWHQSA-N |
| XLogP | 3.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|