C13H26F3N — CID 144511179
ethane;2-methylbut-1-ene;(E)-1,1,1-trifluoro-3-methylpent-2-en-2-amine (PubChem CID 144511179) has the molecular formula C13H26F3N and a molecular weight of 253.35 g/mol. Its IUPAC name is ethane;2-methylbut-1-ene;(E)-1,1,1-trifluoro-3-methylpent-2-en-2-amine.
| Compound Name | ethane;2-methylbut-1-ene;(E)-1,1,1-trifluoro-3-methylpent-2-en-2-amine |
|---|---|
| PubChem CID | 144511179 |
| Molecular Formula | C13H26F3N |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | ethane;2-methylbut-1-ene;(E)-1,1,1-trifluoro-3-methylpent-2-en-2-amine |
| SMILES | C=C(C)CC.CC.CC/C(C)=C(/N)C(F)(F)F |
| InChI | InChI=1S/C6H10F3N.C5H10.C2H6/c1-3-4(2)5(10)6(7,8)9;1-4-5(2)3;1-2/h3,10H2,1-2H3;2,4H2,1,3H3;1-2H3/b5-4+;; |
| InChIKey | PJFGVXMWYTVCLS-SFKRKKMESA-N |
| XLogP | 5.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|