C9H12ClN3O — CID 165133968
N-[C-[(E)-2-chloro-2-(methylideneamino)ethenyl]-N-methylcarbonimidoyl]cyclopropanecarboxamide (PubChem CID 165133968) has the molecular formula C9H12ClN3O and a molecular weight of 213.67 g/mol. Its IUPAC name is N-[C-[(E)-2-chloro-2-(methylideneamino)ethenyl]-N-methylcarbonimidoyl]cyclopropanecarboxamide.
| Compound Name | N-[C-[(E)-2-chloro-2-(methylideneamino)ethenyl]-N-methylcarbonimidoyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 165133968 |
| Molecular Formula | C9H12ClN3O |
| Molecular Weight | 213.67 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | N-[C-[(E)-2-chloro-2-(methylideneamino)ethenyl]-N-methylcarbonimidoyl]cyclopropanecarboxamide |
| SMILES | C=N/C(Cl)=C\C(=N/C)NC(=O)C1CC1 |
| InChI | InChI=1S/C9H12ClN3O/c1-11-7(10)5-8(12-2)13-9(14)6-3-4-6/h5-6H,1,3-4H2,2H3,(H,12,13,14)/b7-5- |
| InChIKey | YJKSWOAECXKROC-ALCCZGGFSA-N |
| XLogP | 1.32 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.67 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|