C12H20ClN3 — CID 134251209
(2Z,4E)-5-chloro-3-N-cyclohexyl-5-(methylideneamino)penta-2,4-diene-2,3-diamine (PubChem CID 134251209) has the molecular formula C12H20ClN3 and a molecular weight of 241.77 g/mol. Its IUPAC name is (2Z,4E)-5-chloro-3-N-cyclohexyl-5-(methylideneamino)penta-2,4-diene-2,3-diamine.
| Compound Name | (2Z,4E)-5-chloro-3-N-cyclohexyl-5-(methylideneamino)penta-2,4-diene-2,3-diamine |
|---|---|
| PubChem CID | 134251209 |
| Molecular Formula | C12H20ClN3 |
| Molecular Weight | 241.77 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (2Z,4E)-5-chloro-3-N-cyclohexyl-5-(methylideneamino)penta-2,4-diene-2,3-diamine |
| SMILES | C=N/C(Cl)=C\C(NC1CCCCC1)=C(/C)N |
| InChI | InChI=1S/C12H20ClN3/c1-9(14)11(8-12(13)15-2)16-10-6-4-3-5-7-10/h8,10,16H,2-7,14H2,1H3/b11-9-,12-8- |
| InChIKey | BACCLJDXNOPBJE-WBWBCYDVSA-N |
| XLogP | 2.88 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|