C12H21F2N3 — CID 122082690
1-cycloheptyl-2-[(1S,2S)-2-(difluoromethyl)cyclopropyl]guanidine (PubChem CID 122082690) has the molecular formula C12H21F2N3 and a molecular weight of 245.32 g/mol. Its IUPAC name is 1-cycloheptyl-2-[(1S,2S)-2-(difluoromethyl)cyclopropyl]guanidine.
| Compound Name | 1-cycloheptyl-2-[(1S,2S)-2-(difluoromethyl)cyclopropyl]guanidine |
|---|---|
| PubChem CID | 122082690 |
| Molecular Formula | C12H21F2N3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | 1-cycloheptyl-2-[(1S,2S)-2-(difluoromethyl)cyclopropyl]guanidine |
| SMILES | N/C(=N\[C@H]1C[C@@H]1C(F)F)NC1CCCCCC1 |
| InChI | InChI=1S/C12H21F2N3/c13-11(14)9-7-10(9)17-12(15)16-8-5-3-1-2-4-6-8/h8-11H,1-7H2,(H3,15,16,17)/t9-,10-/m0/s1 |
| InChIKey | ASLSPBDRFFOHOF-UWVGGRQHSA-N |
| XLogP | 2.27 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|