C12H23N3O2S — CID 62364730
1-cyclohexyl-2-(1,1-dioxothian-4-yl)guanidine (PubChem CID 62364730) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is 1-cyclohexyl-2-(1,1-dioxothian-4-yl)guanidine.
| Compound Name | 1-cyclohexyl-2-(1,1-dioxothian-4-yl)guanidine |
|---|---|
| PubChem CID | 62364730 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-cyclohexyl-2-(1,1-dioxothian-4-yl)guanidine |
| SMILES | N/C(=N\C1CCS(=O)(=O)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C12H23N3O2S/c13-12(14-10-4-2-1-3-5-10)15-11-6-8-18(16,17)9-7-11/h10-11H,1-9H2,(H3,13,14,15) |
| InChIKey | KUWFQNHWPIZFKB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|