C6H13N3O3S — CID 63916146
2-(1,1-dioxothian-3-yl)-1-hydroxyguanidine (PubChem CID 63916146) has the molecular formula C6H13N3O3S and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-(1,1-dioxothian-3-yl)-1-hydroxyguanidine.
| Compound Name | 2-(1,1-dioxothian-3-yl)-1-hydroxyguanidine |
|---|---|
| PubChem CID | 63916146 |
| Molecular Formula | C6H13N3O3S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 2-(1,1-dioxothian-3-yl)-1-hydroxyguanidine |
| SMILES | N/C(=N\C1CCCS(=O)(=O)C1)NO |
| InChI | InChI=1S/C6H13N3O3S/c7-6(9-10)8-5-2-1-3-13(11,12)4-5/h5,10H,1-4H2,(H3,7,8,9) |
| InChIKey | XMOFSTRURVMLBR-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|