About cycloheptylthiourea
cycloheptylthiourea (PubChem CID 13433274) has the molecular formula C8H16N2S
and a molecular weight of 172.30 g/mol. Its IUPAC name is cycloheptylthiourea.
Molecular Properties
| Compound Name | cycloheptylthiourea |
| PubChem CID | 13433274 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | cycloheptylthiourea |
| SMILES | NC(=S)NC1CCCCCC1 |
| InChI | InChI=1S/C8H16N2S/c9-8(11)10-7-5-3-1-2-4-6-7/h7H,1-6H2,(H3,9,10,11) |
| InChIKey | WBNUBZZHHXFAGK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze cycloheptylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptylthiourea?
The IUPAC name of cycloheptylthiourea (CID 13433274) is cycloheptylthiourea.
What is the SMILES notation for cycloheptylthiourea?
The canonical SMILES for cycloheptylthiourea is NC(=S)NC1CCCCCC1.
What is the InChIKey of cycloheptylthiourea?
The InChIKey is WBNUBZZHHXFAGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S/c9-8(11)10-7-5-3-1-2-4-6-7/h7H,1-6H2,(H3,9,10,11).
What are the key properties of cycloheptylthiourea?
cycloheptylthiourea has a molecular weight of 172.30 g/mol, XLogP of 1.54, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptylthiourea is sourced from PubChem (CID 13433274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).