C9H15F3N2S — CID 54395260
(1-cyclohexyl-2,2,2-trifluoroethyl)thiourea (PubChem CID 54395260) has the molecular formula C9H15F3N2S and a molecular weight of 240.29 g/mol. Its IUPAC name is (1-cyclohexyl-2,2,2-trifluoroethyl)thiourea.
| Compound Name | (1-cyclohexyl-2,2,2-trifluoroethyl)thiourea |
|---|---|
| PubChem CID | 54395260 |
| Molecular Formula | C9H15F3N2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (1-cyclohexyl-2,2,2-trifluoroethyl)thiourea |
| SMILES | NC(=S)NC(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2S/c10-9(11,12)7(14-8(13)15)6-4-2-1-3-5-6/h6-7H,1-5H2,(H3,13,14,15) |
| InChIKey | VJMDFMHGSUFAJY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|