About cyclohexylurea;methanamine
cyclohexylurea;methanamine (PubChem CID 142108304) has the molecular formula C8H19N3O
and a molecular weight of 173.26 g/mol. Its IUPAC name is cyclohexylurea;methanamine.
Molecular Properties
| Compound Name | cyclohexylurea;methanamine |
| PubChem CID | 142108304 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | cyclohexylurea;methanamine |
| SMILES | CN.NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C7H14N2O.CH5N/c8-7(10)9-6-4-2-1-3-5-6;1-2/h6H,1-5H2,(H3,8,9,10);2H2,1H3 |
| InChIKey | ZSHFDXXFHVPGNX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexylurea;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylurea;methanamine?
The IUPAC name of cyclohexylurea;methanamine (CID 142108304) is cyclohexylurea;methanamine.
What is the SMILES notation for cyclohexylurea;methanamine?
The canonical SMILES for cyclohexylurea;methanamine is CN.NC(=O)NC1CCCCC1.
What is the InChIKey of cyclohexylurea;methanamine?
The InChIKey is ZSHFDXXFHVPGNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O.CH5N/c8-7(10)9-6-4-2-1-3-5-6;1-2/h6H,1-5H2,(H3,8,9,10);2H2,1H3.
What are the key properties of cyclohexylurea;methanamine?
cyclohexylurea;methanamine has a molecular weight of 173.26 g/mol, XLogP of 0.56, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylurea;methanamine is sourced from PubChem (CID 142108304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).