C6H8F2O — CID 143010384
(3E)-3-(difluoromethoxy)penta-1,3-diene (PubChem CID 143010384) has the molecular formula C6H8F2O and a molecular weight of 134.12 g/mol. Its IUPAC name is (3E)-3-(difluoromethoxy)penta-1,3-diene.
| Compound Name | (3E)-3-(difluoromethoxy)penta-1,3-diene |
|---|---|
| PubChem CID | 143010384 |
| Molecular Formula | C6H8F2O |
| Molecular Weight | 134.12 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | (3E)-3-(difluoromethoxy)penta-1,3-diene |
| SMILES | C=C/C(=C\C)OC(F)F |
| InChI | InChI=1S/C6H8F2O/c1-3-5(4-2)9-6(7)8/h3-4,6H,1H2,2H3/b5-4+ |
| InChIKey | NLXKVGJUUOWSMQ-SNAWJCMRSA-N |
| XLogP | 2.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.12 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|