About (3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene
(3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene (PubChem CID 143342131) has the molecular formula C10H16F2O
and a molecular weight of 190.23 g/mol. Its IUPAC name is (3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene.
Molecular Properties
| Compound Name | (3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene |
| PubChem CID | 143342131 |
| Molecular Formula | C10H16F2O |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene |
| SMILES | CC/C=C(\C=C(/C)CC)OC(F)F |
| InChI | InChI=1S/C10H16F2O/c1-4-6-9(13-10(11)12)7-8(3)5-2/h6-7,10H,4-5H2,1-3H3/b8-7+,9-6+ |
| InChIKey | RDNZMCFRNQQRIZ-KHHFIZIMSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene?
The IUPAC name of (3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene (CID 143342131) is (3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene.
What is the SMILES notation for (3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene?
The canonical SMILES for (3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene is CC/C=C(\C=C(/C)CC)OC(F)F.
What is the InChIKey of (3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene?
The InChIKey is RDNZMCFRNQQRIZ-KHHFIZIMSA-N. The full InChI is InChI=1S/C10H16F2O/c1-4-6-9(13-10(11)12)7-8(3)5-2/h6-7,10H,4-5H2,1-3H3/b8-7+,9-6+.
What are the key properties of (3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene?
(3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene has a molecular weight of 190.23 g/mol, XLogP of 3.88, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-5-(difluoromethoxy)-3-methylocta-3,5-diene is sourced from PubChem (CID 143342131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).