C11H18F2O — CID 163506175
(3Z,5E)-5-(difluoromethoxy)-8-methylnona-3,5-diene (PubChem CID 163506175) has the molecular formula C11H18F2O and a molecular weight of 204.26 g/mol. Its IUPAC name is (3Z,5E)-5-(difluoromethoxy)-8-methylnona-3,5-diene.
| Compound Name | (3Z,5E)-5-(difluoromethoxy)-8-methylnona-3,5-diene |
|---|---|
| PubChem CID | 163506175 |
| Molecular Formula | C11H18F2O |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (3Z,5E)-5-(difluoromethoxy)-8-methylnona-3,5-diene |
| SMILES | CC/C=C\C(=C/CC(C)C)OC(F)F |
| InChI | InChI=1S/C11H18F2O/c1-4-5-6-10(14-11(12)13)8-7-9(2)3/h5-6,8-9,11H,4,7H2,1-3H3/b6-5-,10-8+ |
| InChIKey | CYTJTDMFRDCAPP-UGXDAERVSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|