C17H32F2O — CID 143345673
(3E)-4-(difluoromethoxy)penta-1,3-diene;(Z)-hex-3-ene;2-methylbutane (PubChem CID 143345673) has the molecular formula C17H32F2O and a molecular weight of 290.44 g/mol. Its IUPAC name is (3E)-4-(difluoromethoxy)penta-1,3-diene;(Z)-hex-3-ene;2-methylbutane.
| Compound Name | (3E)-4-(difluoromethoxy)penta-1,3-diene;(Z)-hex-3-ene;2-methylbutane |
|---|---|
| PubChem CID | 143345673 |
| Molecular Formula | C17H32F2O |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | (3E)-4-(difluoromethoxy)penta-1,3-diene;(Z)-hex-3-ene;2-methylbutane |
| SMILES | C=C/C=C(\C)OC(F)F.CC/C=C\CC.CCC(C)C |
| InChI | InChI=1S/C6H8F2O.C6H12.C5H12/c1-3-4-5(2)9-6(7)8;1-3-5-6-4-2;1-4-5(2)3/h3-4,6H,1H2,2H3;5-6H,3-4H2,1-2H3;5H,4H2,1-3H3/b5-4+;6-5-; |
| InChIKey | UYVAZXMSJQXTFP-ZHQUAHTOSA-N |
| XLogP | 6.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|