About (3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene
(3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene (PubChem CID 58597093) has the molecular formula C11H20S
and a molecular weight of 184.35 g/mol. Its IUPAC name is (3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene.
Molecular Properties
| Compound Name | (3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene |
| PubChem CID | 58597093 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene |
| SMILES | C=C/C=C(\C)[C@H](CC)SC(C)C |
| InChI | InChI=1S/C11H20S/c1-6-8-10(5)11(7-2)12-9(3)4/h6,8-9,11H,1,7H2,2-5H3/b10-8+/t11-/m0/s1 |
| InChIKey | UQKVTVCSLBMSRW-UQSGXBNBSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene?
The IUPAC name of (3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene (CID 58597093) is (3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene.
What is the SMILES notation for (3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene?
The canonical SMILES for (3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene is C=C/C=C(\C)[C@H](CC)SC(C)C.
What is the InChIKey of (3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene?
The InChIKey is UQKVTVCSLBMSRW-UQSGXBNBSA-N. The full InChI is InChI=1S/C11H20S/c1-6-8-10(5)11(7-2)12-9(3)4/h6,8-9,11H,1,7H2,2-5H3/b10-8+/t11-/m0/s1.
What are the key properties of (3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene?
(3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene has a molecular weight of 184.35 g/mol, XLogP of 4.04, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5S)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene is sourced from PubChem (CID 58597093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).