C14H15F3 — CID 143254016
1,2,4-trifluoro-3-[(2E,4Z)-5-methylhepta-2,4-dien-3-yl]benzene (PubChem CID 143254016) has the molecular formula C14H15F3 and a molecular weight of 240.27 g/mol. Its IUPAC name is 1,2,4-trifluoro-3-[(2E,4Z)-5-methylhepta-2,4-dien-3-yl]benzene.
| Compound Name | 1,2,4-trifluoro-3-[(2E,4Z)-5-methylhepta-2,4-dien-3-yl]benzene |
|---|---|
| PubChem CID | 143254016 |
| Molecular Formula | C14H15F3 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1,2,4-trifluoro-3-[(2E,4Z)-5-methylhepta-2,4-dien-3-yl]benzene |
| SMILES | C/C=C(\C=C(\C)CC)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C14H15F3/c1-4-9(3)8-10(5-2)13-11(15)6-7-12(16)14(13)17/h5-8H,4H2,1-3H3/b9-8-,10-5+ |
| InChIKey | PWDZWESMUOSRRX-JMJQRBITSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|