About 3-methylpent-2-ene;zirconium
3-methylpent-2-ene;zirconium (PubChem CID 174393280) has the molecular formula C6H12Zr
and a molecular weight of 175.39 g/mol. Its IUPAC name is 3-methylpent-2-ene;zirconium.
Molecular Properties
| Compound Name | 3-methylpent-2-ene;zirconium |
| PubChem CID | 174393280 |
| Molecular Formula | C6H12Zr |
| Molecular Weight | 175.39 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | 3-methylpent-2-ene;zirconium |
| SMILES | CC=C(C)CC.[Zr] |
| InChI | InChI=1S/C6H12.Zr/c1-4-6(3)5-2;/h4H,5H2,1-3H3; |
| InChIKey | YPMOBWRCJJVGRI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpent-2-ene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpent-2-ene;zirconium?
The IUPAC name of 3-methylpent-2-ene;zirconium (CID 174393280) is 3-methylpent-2-ene;zirconium.
What is the SMILES notation for 3-methylpent-2-ene;zirconium?
The canonical SMILES for 3-methylpent-2-ene;zirconium is CC=C(C)CC.[Zr].
What is the InChIKey of 3-methylpent-2-ene;zirconium?
The InChIKey is YPMOBWRCJJVGRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.Zr/c1-4-6(3)5-2;/h4H,5H2,1-3H3;.
What are the key properties of 3-methylpent-2-ene;zirconium?
3-methylpent-2-ene;zirconium has a molecular weight of 175.39 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpent-2-ene;zirconium is sourced from PubChem (CID 174393280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).