About ethane;(E)-3-methylpent-2-ene
ethane;(E)-3-methylpent-2-ene (PubChem CID 144523626) has the molecular formula C14H36
and a molecular weight of 204.44 g/mol. Its IUPAC name is ethane;(E)-3-methylpent-2-ene.
Molecular Properties
| Compound Name | ethane;(E)-3-methylpent-2-ene |
| PubChem CID | 144523626 |
| Molecular Formula | C14H36 |
| Molecular Weight | 204.44 g/mol |
| Exact Mass | 204.28 |
| IUPAC Name | ethane;(E)-3-methylpent-2-ene |
| SMILES | C/C=C(\C)CC.CC.CC.CC.CC |
| InChI | InChI=1S/C6H12.4C2H6/c1-4-6(3)5-2;4*1-2/h4H,5H2,1-3H3;4*1-2H3/b6-4+;;;; |
| InChIKey | LFOAKJVOWPSYRM-MVWLXSBUSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 204.44 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-3-methylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-3-methylpent-2-ene?
The IUPAC name of ethane;(E)-3-methylpent-2-ene (CID 144523626) is ethane;(E)-3-methylpent-2-ene.
What is the SMILES notation for ethane;(E)-3-methylpent-2-ene?
The canonical SMILES for ethane;(E)-3-methylpent-2-ene is C/C=C(\C)CC.CC.CC.CC.CC.
What is the InChIKey of ethane;(E)-3-methylpent-2-ene?
The InChIKey is LFOAKJVOWPSYRM-MVWLXSBUSA-N. The full InChI is InChI=1S/C6H12.4C2H6/c1-4-6(3)5-2;4*1-2/h4H,5H2,1-3H3;4*1-2H3/b6-4+;;;;.
What are the key properties of ethane;(E)-3-methylpent-2-ene?
ethane;(E)-3-methylpent-2-ene has a molecular weight of 204.44 g/mol, XLogP of 6.47, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-3-methylpent-2-ene is sourced from PubChem (CID 144523626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).