C12H17FO — CID 123931875
4-ethenyl-3-ethylidene-2-(1-fluoroethoxy)hexa-1,4-diene (PubChem CID 123931875) has the molecular formula C12H17FO and a molecular weight of 196.26 g/mol. Its IUPAC name is 4-ethenyl-3-ethylidene-2-(1-fluoroethoxy)hexa-1,4-diene.
| Compound Name | 4-ethenyl-3-ethylidene-2-(1-fluoroethoxy)hexa-1,4-diene |
|---|---|
| PubChem CID | 123931875 |
| Molecular Formula | C12H17FO |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 4-ethenyl-3-ethylidene-2-(1-fluoroethoxy)hexa-1,4-diene |
| SMILES | C=CC(=CC)C(=CC)C(=C)OC(C)F |
| InChI | InChI=1S/C12H17FO/c1-6-11(7-2)12(8-3)9(4)14-10(5)13/h6-8,10H,1,4H2,2-3,5H3 |
| InChIKey | TUBYLTMICGIZEL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|