C12H21N — CID 170733911
(3E,4E)-3-ethylidene-4-methylhexa-1,4-diene;N-ethylmethanimine (PubChem CID 170733911) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (3E,4E)-3-ethylidene-4-methylhexa-1,4-diene;N-ethylmethanimine.
| Compound Name | (3E,4E)-3-ethylidene-4-methylhexa-1,4-diene;N-ethylmethanimine |
|---|---|
| PubChem CID | 170733911 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (3E,4E)-3-ethylidene-4-methylhexa-1,4-diene;N-ethylmethanimine |
| SMILES | C=CC(=C\C)/C(C)=C/C.C=NCC |
| InChI | InChI=1S/C9H14.C3H7N/c1-5-8(4)9(6-2)7-3;1-3-4-2/h5-7H,2H2,1,3-4H3;2-3H2,1H3/b8-5+,9-7+; |
| InChIKey | FALMBHPKWMVUAK-DRQDVJCFSA-N |
| XLogP | 3.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|