C16H16F2O2 — CID 145479643
(3E,9Z)-11-(difluoromethoxy)-10-methyl-5,8-dimethylidenedodeca-1,3,9,11-tetraen-6-yn-3-ol (PubChem CID 145479643) has the molecular formula C16H16F2O2 and a molecular weight of 278.30 g/mol. Its IUPAC name is (3E,9Z)-11-(difluoromethoxy)-10-methyl-5,8-dimethylidenedodeca-1,3,9,11-tetraen-6-yn-3-ol.
| Compound Name | (3E,9Z)-11-(difluoromethoxy)-10-methyl-5,8-dimethylidenedodeca-1,3,9,11-tetraen-6-yn-3-ol |
|---|---|
| PubChem CID | 145479643 |
| Molecular Formula | C16H16F2O2 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (3E,9Z)-11-(difluoromethoxy)-10-methyl-5,8-dimethylidenedodeca-1,3,9,11-tetraen-6-yn-3-ol |
| SMILES | C=C/C(O)=C\C(=C)C#CC(=C)/C=C(/C)C(=C)OC(F)F |
| InChI | InChI=1S/C16H16F2O2/c1-6-15(19)10-12(3)8-7-11(2)9-13(4)14(5)20-16(17)18/h6,9-10,16,19H,1-3,5H2,4H3/b13-9-,15-10+ |
| InChIKey | YNRVCMYTRDXJIZ-AYMWWVTDSA-N |
| XLogP | 4.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|