C9H14O2 — CID 142132997
(2E,4E)-3-ethylhepta-2,4,6-triene-2,5-diol (PubChem CID 142132997) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (2E,4E)-3-ethylhepta-2,4,6-triene-2,5-diol.
| Compound Name | (2E,4E)-3-ethylhepta-2,4,6-triene-2,5-diol |
|---|---|
| PubChem CID | 142132997 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (2E,4E)-3-ethylhepta-2,4,6-triene-2,5-diol |
| SMILES | C=C/C(O)=C\C(CC)=C(/C)O |
| InChI | InChI=1S/C9H14O2/c1-4-8(7(3)10)6-9(11)5-2/h5-6,10-11H,2,4H2,1,3H3/b8-7+,9-6+ |
| InChIKey | BQEQIFMWJDXKEI-KHHFIZIMSA-N |
| XLogP | 2.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|