C18H34N+ — CID 155706575
ethane;ethenyl-[(4Z)-4-ethenylhexa-1,4-dien-3-ylidene]-(2-methylpropyl)azanium (PubChem CID 155706575) has the molecular formula C18H34N+ and a molecular weight of 264.48 g/mol. Its IUPAC name is ethane;ethenyl-[(4Z)-4-ethenylhexa-1,4-dien-3-ylidene]-(2-methylpropyl)azanium.
| Compound Name | ethane;ethenyl-[(4Z)-4-ethenylhexa-1,4-dien-3-ylidene]-(2-methylpropyl)azanium |
|---|---|
| PubChem CID | 155706575 |
| Molecular Formula | C18H34N+ |
| Molecular Weight | 264.48 g/mol |
| Exact Mass | 264.27 |
| IUPAC Name | ethane;ethenyl-[(4Z)-4-ethenylhexa-1,4-dien-3-ylidene]-(2-methylpropyl)azanium |
| SMILES | C=CC(/C(C=C)=C\C)=[N+](C=C)CC(C)C.CC.CC |
| InChI | InChI=1S/C14H22N.2C2H6/c1-7-13(8-2)14(9-3)15(10-4)11-12(5)6;2*1-2/h7-10,12H,1,3-4,11H2,2,5-6H3;2*1-2H3/q+1;;/b13-8-,15-14+;; |
| InChIKey | OKCOFJHUQZNERA-KMMIRDCSSA-N |
| XLogP | 5.61 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|